C20H24N5O9P — CID 159381580
(2,5-dioxopyrrolidin-1-yl) 3-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphoryl]amino]propanoate (PubChem CID 159381580) has the molecular formula C20H24N5O9P and a molecular weight of 509.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphoryl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159381580 |
| Molecular Formula | C20H24N5O9P |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[[2-(2,5-dioxopyrrol-1-yl)ethylamino]-[3-(2,5-dioxopyrrol-1-yl)propyl]phosphoryl]amino]propanoate |
| SMILES | O=C(CCNP(=O)(CCCN1C(=O)C=CC1=O)NCCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H24N5O9P/c26-14-2-3-15(27)23(14)11-1-13-35(33,22-10-12-24-16(28)4-5-17(24)29)21-9-8-20(32)34-25-18(30)6-7-19(25)31/h2-5H,1,6-13H2,(H2,21,22,33) |
| InChIKey | NIMONNZWNNEUGR-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|