C18H26N4O6 — CID 159381920
1-[3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-ylmethylamino)propyl]-1,3-diazinan-2-one;oxalic acid (PubChem CID 159381920) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-ylmethylamino)propyl]-1,3-diazinan-2-one;oxalic acid.
| Compound Name | 1-[3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-ylmethylamino)propyl]-1,3-diazinan-2-one;oxalic acid |
|---|---|
| PubChem CID | 159381920 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-2-ylmethylamino)propyl]-1,3-diazinan-2-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C1NCCCN1CCCNCC1CCc2cccnc2O1 |
| InChI | InChI=1S/C16H24N4O2.C2H2O4/c21-16-19-9-3-11-20(16)10-2-7-17-12-14-6-5-13-4-1-8-18-15(13)22-14;3-1(4)2(5)6/h1,4,8,14,17H,2-3,5-7,9-12H2,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | LLACWGUJRPMDMA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|