C17H12N4O2S — CID 15938198
6-(2-methylphenyl)-2-phenyl-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one (PubChem CID 15938198) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 6-(2-methylphenyl)-2-phenyl-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one.
| Compound Name | 6-(2-methylphenyl)-2-phenyl-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 15938198 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 6-(2-methylphenyl)-2-phenyl-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
| SMILES | Cc1ccccc1-n1c(=O)nc2oc(-c3ccccc3)nn2c1=S |
| InChI | InChI=1S/C17H12N4O2S/c1-11-7-5-6-10-13(11)20-15(22)18-16-21(17(20)24)19-14(23-16)12-8-3-2-4-9-12/h2-10H,1H3 |
| InChIKey | BOBKPCJRIGFESS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|