C14H18O3S2 — CID 159382818
2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undec-9-ene-3,6-dione (PubChem CID 159382818) has the molecular formula C14H18O3S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undec-9-ene-3,6-dione.
| Compound Name | 2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
|---|---|
| PubChem CID | 159382818 |
| Molecular Formula | C14H18O3S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-methoxy-4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
| SMILES | COC12C(=O)C(SC)C(SC)C(=O)C1C1C=CC2C1 |
| InChI | InChI=1S/C14H18O3S2/c1-17-14-8-5-4-7(6-8)9(14)10(15)11(18-2)12(19-3)13(14)16/h4-5,7-9,11-12H,6H2,1-3H3 |
| InChIKey | FCJMJDKPMPVPPM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|