C15H32N2Si4 — CID 15938336
trimethyl-(2,2,4-trimethyl-4-phenyl-3-trimethylsilyl-1,3,2,4-diazadisiletidin-1-yl)silane (PubChem CID 15938336) has the molecular formula C15H32N2Si4 and a molecular weight of 352.78 g/mol. Its IUPAC name is trimethyl-(2,2,4-trimethyl-4-phenyl-3-trimethylsilyl-1,3,2,4-diazadisiletidin-1-yl)silane.
| Compound Name | trimethyl-(2,2,4-trimethyl-4-phenyl-3-trimethylsilyl-1,3,2,4-diazadisiletidin-1-yl)silane |
|---|---|
| PubChem CID | 15938336 |
| Molecular Formula | C15H32N2Si4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | trimethyl-(2,2,4-trimethyl-4-phenyl-3-trimethylsilyl-1,3,2,4-diazadisiletidin-1-yl)silane |
| SMILES | C[Si](C)(C)N1[Si](C)(C)N([Si](C)(C)C)[Si]1(C)c1ccccc1 |
| InChI | InChI=1S/C15H32N2Si4/c1-18(2,3)16-20(7,8)17(19(4,5)6)21(16,9)15-13-11-10-12-14-15/h10-14H,1-9H3 |
| InChIKey | PGDNJWHYJFDDAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|