C16H24 — CID 159384776
1-[(Z)-cyclobut-2-en-1-ylidenemethyl]-3a,4,6a-trimethyl-1,2,3,4,5,6-hexahydropentalene (PubChem CID 159384776) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-[(Z)-cyclobut-2-en-1-ylidenemethyl]-3a,4,6a-trimethyl-1,2,3,4,5,6-hexahydropentalene.
| Compound Name | 1-[(Z)-cyclobut-2-en-1-ylidenemethyl]-3a,4,6a-trimethyl-1,2,3,4,5,6-hexahydropentalene |
|---|---|
| PubChem CID | 159384776 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1-[(Z)-cyclobut-2-en-1-ylidenemethyl]-3a,4,6a-trimethyl-1,2,3,4,5,6-hexahydropentalene |
| SMILES | CC1CCC2(C)C(/C=C3\C=CC3)CCC12C |
| InChI | InChI=1S/C16H24/c1-12-7-9-16(3)14(8-10-15(12,16)2)11-13-5-4-6-13/h4-5,11-12,14H,6-10H2,1-3H3/b13-11+ |
| InChIKey | LLIYTANCWCLUEG-ACCUITESSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |