C25H30ClF3N2O4 — CID 159385476
carbon dioxide;7-chloro-N-[[4-(4,4,4-trifluorobutyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;propanoic acid (PubChem CID 159385476) has the molecular formula C25H30ClF3N2O4 and a molecular weight of 514.97 g/mol. Its IUPAC name is carbon dioxide;7-chloro-N-[[4-(4,4,4-trifluorobutyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;propanoic acid.
| Compound Name | carbon dioxide;7-chloro-N-[[4-(4,4,4-trifluorobutyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;propanoic acid |
|---|---|
| PubChem CID | 159385476 |
| Molecular Formula | C25H30ClF3N2O4 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | carbon dioxide;7-chloro-N-[[4-(4,4,4-trifluorobutyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;propanoic acid |
| SMILES | CCC(=O)O.FC(F)(F)CCCc1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C=O |
| InChI | InChI=1S/C21H24ClF3N2.C3H6O2.CO2/c22-19-8-7-17-9-12-26-13-10-18(17)20(19)27-14-16-5-3-15(4-6-16)2-1-11-21(23,24)25;1-2-3(4)5;2-1-3/h3-8,26-27H,1-2,9-14H2;2H2,1H3,(H,4,5); |
| InChIKey | LLLAUPIJGBAETP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |