About N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane
N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane (PubChem CID 159385518) has the molecular formula C15H28N2S2
and a molecular weight of 300.54 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane |
| PubChem CID | 159385518 |
| Molecular Formula | C15H28N2S2 |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CSSC |
| InChI | InChI=1S/C13H22N2.C2H6S2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-3-4-2/h12-13H,1-10H2;1-2H3 |
| InChIKey | LLLDLYIDQAKBRA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane?
The IUPAC name of N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane (CID 159385518) is N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane is C(=NC1CCCCC1)=NC1CCCCC1.CSSC.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane?
The InChIKey is LLLDLYIDQAKBRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C2H6S2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-3-4-2/h12-13H,1-10H2;1-2H3.
What are the key properties of N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane?
N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane has a molecular weight of 300.54 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;(methyldisulfanyl)methane is sourced from PubChem (CID 159385518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).