C29H27BrN4 — CID 159387073
2-bromo-3-methylaniline;2-methylbenzonitrile;1-methylphenanthridin-6-amine (PubChem CID 159387073) has the molecular formula C29H27BrN4 and a molecular weight of 511.47 g/mol. Its IUPAC name is 2-bromo-3-methylaniline;2-methylbenzonitrile;1-methylphenanthridin-6-amine.
| Compound Name | 2-bromo-3-methylaniline;2-methylbenzonitrile;1-methylphenanthridin-6-amine |
|---|---|
| PubChem CID | 159387073 |
| Molecular Formula | C29H27BrN4 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-bromo-3-methylaniline;2-methylbenzonitrile;1-methylphenanthridin-6-amine |
| SMILES | Cc1cccc(N)c1Br.Cc1cccc2nc(N)c3ccccc3c12.Cc1ccccc1C#N |
| InChI | InChI=1S/C14H12N2.C8H7N.C7H8BrN/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14(15)16-12;1-7-4-2-3-5-8(7)6-9;1-5-3-2-4-6(9)7(5)8/h2-8H,1H3,(H2,15,16);2-5H,1H3;2-4H,9H2,1H3 |
| InChIKey | LLQBKFMMYNAXEJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|