About diphenyldiazene;naphthalen-1-amine
diphenyldiazene;naphthalen-1-amine (PubChem CID 159387194) has the molecular formula C22H19N3
and a molecular weight of 325.42 g/mol. Its IUPAC name is diphenyldiazene;naphthalen-1-amine.
Molecular Properties
| Compound Name | diphenyldiazene;naphthalen-1-amine |
| PubChem CID | 159387194 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | diphenyldiazene;naphthalen-1-amine |
| SMILES | Nc1cccc2ccccc12.c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2.C10H9N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;11-10-7-3-5-8-4-1-2-6-9(8)10/h1-10H;1-7H,11H2/b14-13+; |
| InChIKey | LLQLQSINOZPHDD-IERUDJENSA-N |
| XLogP | 6.52 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene;naphthalen-1-amine?
The IUPAC name of diphenyldiazene;naphthalen-1-amine (CID 159387194) is diphenyldiazene;naphthalen-1-amine.
What is the SMILES notation for diphenyldiazene;naphthalen-1-amine?
The canonical SMILES for diphenyldiazene;naphthalen-1-amine is Nc1cccc2ccccc12.c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene;naphthalen-1-amine?
The InChIKey is LLQLQSINOZPHDD-IERUDJENSA-N. The full InChI is InChI=1S/C12H10N2.C10H9N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;11-10-7-3-5-8-4-1-2-6-9(8)10/h1-10H;1-7H,11H2/b14-13+;.
What are the key properties of diphenyldiazene;naphthalen-1-amine?
diphenyldiazene;naphthalen-1-amine has a molecular weight of 325.42 g/mol, XLogP of 6.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene;naphthalen-1-amine is sourced from PubChem (CID 159387194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).