About hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine
hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine (PubChem CID 159387391) has the molecular formula C3H6N3O8P3+2
and a molecular weight of 305.02 g/mol. Its IUPAC name is hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine.
Molecular Properties
| Compound Name | hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine |
| PubChem CID | 159387391 |
| Molecular Formula | C3H6N3O8P3+2 |
| Molecular Weight | 305.02 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine |
| SMILES | O=[P+](O)OP(=O)(O)O[P+](=O)O.c1cnnnc1 |
| InChI | InChI=1S/C3H3N3.HO8P3/c1-2-4-6-5-3-1;1-9(2)7-11(5,6)8-10(3)4/h1-3H;(H-2,1,2,3,4,5,6)/p+2 |
| InChIKey | LAWNCAODDCDZQN-UHFFFAOYSA-P |
| XLogP | 0.29 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.02 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine?
The IUPAC name of hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine (CID 159387391) is hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine.
What is the SMILES notation for hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine?
The canonical SMILES for hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine is O=[P+](O)OP(=O)(O)O[P+](=O)O.c1cnnnc1.
What is the InChIKey of hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine?
The InChIKey is LAWNCAODDCDZQN-UHFFFAOYSA-P. The full InChI is InChI=1S/C3H3N3.HO8P3/c1-2-4-6-5-3-1;1-9(2)7-11(5,6)8-10(3)4/h1-3H;(H-2,1,2,3,4,5,6)/p+2.
What are the key properties of hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine?
hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine has a molecular weight of 305.02 g/mol, XLogP of 0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;triazine is sourced from PubChem (CID 159387391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).