About quinoline;2,3,4-trimethyl-1H-indole
quinoline;2,3,4-trimethyl-1H-indole (PubChem CID 159387444) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is quinoline;2,3,4-trimethyl-1H-indole.
Molecular Properties
| Compound Name | quinoline;2,3,4-trimethyl-1H-indole |
| PubChem CID | 159387444 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | quinoline;2,3,4-trimethyl-1H-indole |
| SMILES | Cc1[nH]c2cccc(C)c2c1C.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C11H13N.C9H7N/c1-7-5-4-6-10-11(7)8(2)9(3)12-10;1-2-6-9-8(4-1)5-3-7-10-9/h4-6,12H,1-3H3;1-7H |
| InChIKey | LLRHKMQQOHWOIP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze quinoline;2,3,4-trimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;2,3,4-trimethyl-1H-indole?
The IUPAC name of quinoline;2,3,4-trimethyl-1H-indole (CID 159387444) is quinoline;2,3,4-trimethyl-1H-indole.
What is the SMILES notation for quinoline;2,3,4-trimethyl-1H-indole?
The canonical SMILES for quinoline;2,3,4-trimethyl-1H-indole is Cc1[nH]c2cccc(C)c2c1C.c1ccc2ncccc2c1.
What is the InChIKey of quinoline;2,3,4-trimethyl-1H-indole?
The InChIKey is LLRHKMQQOHWOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.C9H7N/c1-7-5-4-6-10-11(7)8(2)9(3)12-10;1-2-6-9-8(4-1)5-3-7-10-9/h4-6,12H,1-3H3;1-7H.
What are the key properties of quinoline;2,3,4-trimethyl-1H-indole?
quinoline;2,3,4-trimethyl-1H-indole has a molecular weight of 288.39 g/mol, XLogP of 5.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;2,3,4-trimethyl-1H-indole is sourced from PubChem (CID 159387444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).