C13H20F3NO4 — CID 159388283
4-[(Z)-prop-1-enyl]-1-propylpyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 159388283) has the molecular formula C13H20F3NO4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-[(Z)-prop-1-enyl]-1-propylpyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(Z)-prop-1-enyl]-1-propylpyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159388283 |
| Molecular Formula | C13H20F3NO4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-[(Z)-prop-1-enyl]-1-propylpyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C=C\C1CC(C(=O)O)N(CCC)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H19NO2.C2HF3O2/c1-3-5-9-7-10(11(13)14)12(8-9)6-4-2;3-2(4,5)1(6)7/h3,5,9-10H,4,6-8H2,1-2H3,(H,13,14);(H,6,7)/b5-3-; |
| InChIKey | LLTYQUWTPCSZAA-FBZPGIPVSA-N |
| XLogP | 2.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|