About 1,3-oxazole;quinolin-2-amine
1,3-oxazole;quinolin-2-amine (PubChem CID 159388854) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 1,3-oxazole;quinolin-2-amine.
Molecular Properties
| Compound Name | 1,3-oxazole;quinolin-2-amine |
| PubChem CID | 159388854 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1,3-oxazole;quinolin-2-amine |
| SMILES | Nc1ccc2ccccc2n1.c1cocn1 |
| InChI | InChI=1S/C9H8N2.C3H3NO/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-5-3-4-1/h1-6H,(H2,10,11);1-3H |
| InChIKey | LLVVZLHSHXXPJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-oxazole;quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazole;quinolin-2-amine?
The IUPAC name of 1,3-oxazole;quinolin-2-amine (CID 159388854) is 1,3-oxazole;quinolin-2-amine.
What is the SMILES notation for 1,3-oxazole;quinolin-2-amine?
The canonical SMILES for 1,3-oxazole;quinolin-2-amine is Nc1ccc2ccccc2n1.c1cocn1.
What is the InChIKey of 1,3-oxazole;quinolin-2-amine?
The InChIKey is LLVVZLHSHXXPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C3H3NO/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-5-3-4-1/h1-6H,(H2,10,11);1-3H.
What are the key properties of 1,3-oxazole;quinolin-2-amine?
1,3-oxazole;quinolin-2-amine has a molecular weight of 213.24 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazole;quinolin-2-amine is sourced from PubChem (CID 159388854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).