C42H54N2O4 — CID 159390403
ethane;1-[2-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one;1-[3-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one (PubChem CID 159390403) has the molecular formula C42H54N2O4 and a molecular weight of 650.90 g/mol. Its IUPAC name is ethane;1-[2-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one;1-[3-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one.
| Compound Name | ethane;1-[2-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one;1-[3-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one |
|---|---|
| PubChem CID | 159390403 |
| Molecular Formula | C42H54N2O4 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | ethane;1-[2-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one;1-[3-[(3-isocyanophenyl)methyl]phenoxy]propan-2-one |
| SMILES | CC.CC.CC.CC.[C-]#[N+]c1cccc(Cc2cccc(OCC(C)=O)c2)c1.[C-]#[N+]c1cccc(Cc2ccccc2OCC(C)=O)c1 |
| InChI | InChI=1S/2C17H15NO2.4C2H6/c1-13(19)12-20-17-8-4-6-15(11-17)9-14-5-3-7-16(10-14)18-2;1-13(19)12-20-17-9-4-3-7-15(17)10-14-6-5-8-16(11-14)18-2;4*1-2/h3-8,10-11H,9,12H2,1H3;3-9,11H,10,12H2,1H3;4*1-2H3 |
| InChIKey | LMAPKVWOGIJQRD-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 61.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|