About (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile
(6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile (PubChem CID 15939095) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile |
| PubChem CID | 15939095 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile |
| SMILES | CN1CCC=C[C@@H]1C#N |
| InChI | InChI=1S/C7H10N2/c1-9-5-3-2-4-7(9)6-8/h2,4,7H,3,5H2,1H3/t7-/m1/s1 |
| InChIKey | XPGCXCNNIYNUMX-SSDOTTSWSA-N |
| XLogP | 0.77 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile?
The IUPAC name of (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile (CID 15939095) is (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile.
What is the SMILES notation for (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile?
The canonical SMILES for (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile is CN1CCC=C[C@@H]1C#N.
What is the InChIKey of (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile?
The InChIKey is XPGCXCNNIYNUMX-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H10N2/c1-9-5-3-2-4-7(9)6-8/h2,4,7H,3,5H2,1H3/t7-/m1/s1.
What are the key properties of (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile?
(6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile has a molecular weight of 122.17 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1-methyl-3,6-dihydro-2H-pyridine-6-carbonitrile is sourced from PubChem (CID 15939095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).