C11H13NO5 — CID 15939116
methyl (7aR)-7a-nitro-5-oxo-2,3,6,7-tetrahydro-1H-indene-4-carboxylate (PubChem CID 15939116) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is methyl (7aR)-7a-nitro-5-oxo-2,3,6,7-tetrahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (7aR)-7a-nitro-5-oxo-2,3,6,7-tetrahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 15939116 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | methyl (7aR)-7a-nitro-5-oxo-2,3,6,7-tetrahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)C1=C2CCC[C@@]2([N+](=O)[O-])CCC1=O |
| InChI | InChI=1S/C11H13NO5/c1-17-10(14)9-7-3-2-5-11(7,12(15)16)6-4-8(9)13/h2-6H2,1H3/t11-/m1/s1 |
| InChIKey | OQODOYCINJEDBX-LLVKDONJSA-N |
| XLogP | 1.02 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|