About (3S)-3-methyl-2,3-dihydro-1-benzofuran
(3S)-3-methyl-2,3-dihydro-1-benzofuran (PubChem CID 15939192) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is (3S)-3-methyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | (3S)-3-methyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 15939192 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (3S)-3-methyl-2,3-dihydro-1-benzofuran |
| SMILES | C[C@@H]1COc2ccccc21 |
| InChI | InChI=1S/C9H10O/c1-7-6-10-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3/t7-/m1/s1 |
| InChIKey | YZDGROPVYQGZTK-SSDOTTSWSA-N |
| XLogP | 2.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-methyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-2,3-dihydro-1-benzofuran?
The IUPAC name of (3S)-3-methyl-2,3-dihydro-1-benzofuran (CID 15939192) is (3S)-3-methyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for (3S)-3-methyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for (3S)-3-methyl-2,3-dihydro-1-benzofuran is C[C@@H]1COc2ccccc21.
What is the InChIKey of (3S)-3-methyl-2,3-dihydro-1-benzofuran?
The InChIKey is YZDGROPVYQGZTK-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H10O/c1-7-6-10-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3/t7-/m1/s1.
What are the key properties of (3S)-3-methyl-2,3-dihydro-1-benzofuran?
(3S)-3-methyl-2,3-dihydro-1-benzofuran has a molecular weight of 134.18 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 15939192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).