About 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran
5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran (PubChem CID 159391992) has the molecular formula C12H13ClO3
and a molecular weight of 240.69 g/mol. Its IUPAC name is 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran.
Molecular Properties
| Compound Name | 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran |
| PubChem CID | 159391992 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran |
| SMILES | Cc1ccc(C)o1.O=Cc1ccc(CCl)o1 |
| InChI | InChI=1S/C6H5ClO2.C6H8O/c7-3-5-1-2-6(4-8)9-5;1-5-3-4-6(2)7-5/h1-2,4H,3H2;3-4H,1-2H3 |
| InChIKey | LMFSAYXCWIDLKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran?
The IUPAC name of 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran (CID 159391992) is 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran.
What is the SMILES notation for 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran?
The canonical SMILES for 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran is Cc1ccc(C)o1.O=Cc1ccc(CCl)o1.
What is the InChIKey of 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran?
The InChIKey is LMFSAYXCWIDLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2.C6H8O/c7-3-5-1-2-6(4-8)9-5;1-5-3-4-6(2)7-5/h1-2,4H,3H2;3-4H,1-2H3.
What are the key properties of 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran?
5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran has a molecular weight of 240.69 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)furan-2-carbaldehyde;2,5-dimethylfuran is sourced from PubChem (CID 159391992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).