About 1-ethenyl-2-ethylpyrrole
1-ethenyl-2-ethylpyrrole (PubChem CID 15939209) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 1-ethenyl-2-ethylpyrrole.
Molecular Properties
| Compound Name | 1-ethenyl-2-ethylpyrrole |
| PubChem CID | 15939209 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 1-ethenyl-2-ethylpyrrole |
| SMILES | C=Cn1cccc1CC |
| InChI | InChI=1S/C8H11N/c1-3-8-6-5-7-9(8)4-2/h4-7H,2-3H2,1H3 |
| InChIKey | UNEMETBUNALGIO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-2-ethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-ethylpyrrole?
The IUPAC name of 1-ethenyl-2-ethylpyrrole (CID 15939209) is 1-ethenyl-2-ethylpyrrole.
What is the SMILES notation for 1-ethenyl-2-ethylpyrrole?
The canonical SMILES for 1-ethenyl-2-ethylpyrrole is C=Cn1cccc1CC.
What is the InChIKey of 1-ethenyl-2-ethylpyrrole?
The InChIKey is UNEMETBUNALGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-3-8-6-5-7-9(8)4-2/h4-7H,2-3H2,1H3.
What are the key properties of 1-ethenyl-2-ethylpyrrole?
1-ethenyl-2-ethylpyrrole has a molecular weight of 121.18 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethylpyrrole is sourced from PubChem (CID 15939209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).