About bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane
bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane (PubChem CID 159392273) has the molecular formula C15H17P
and a molecular weight of 228.27 g/mol. Its IUPAC name is bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane.
Molecular Properties
| Compound Name | bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane |
| PubChem CID | 159392273 |
| Molecular Formula | C15H17P |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane |
| SMILES | C=C/C=C/P(/C=C/C=C)c1ccccc1C |
| InChI | InChI=1S/C15H17P/c1-4-6-12-16(13-7-5-2)15-11-9-8-10-14(15)3/h4-13H,1-2H2,3H3/b12-6+,13-7+ |
| InChIKey | DBGMUMBJAORKQL-PWHKKFIBSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane?
The IUPAC name of bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane (CID 159392273) is bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane.
What is the SMILES notation for bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane?
The canonical SMILES for bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane is C=C/C=C/P(/C=C/C=C)c1ccccc1C.
What is the InChIKey of bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane?
The InChIKey is DBGMUMBJAORKQL-PWHKKFIBSA-N. The full InChI is InChI=1S/C15H17P/c1-4-6-12-16(13-7-5-2)15-11-9-8-10-14(15)3/h4-13H,1-2H2,3H3/b12-6+,13-7+.
What are the key properties of bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane?
bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane has a molecular weight of 228.27 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(1E)-buta-1,3-dienyl]-(2-methylphenyl)phosphane is sourced from PubChem (CID 159392273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).