About methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate
methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 159392495) has the molecular formula C23H27F3O7S
and a molecular weight of 504.52 g/mol. Its IUPAC name is methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate.
Molecular Properties
| Compound Name | methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate |
| PubChem CID | 159392495 |
| Molecular Formula | C23H27F3O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | CCCCCCc1ccc(C(=O)OC)cc1.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20O2.C9H7F3O5S/c1-3-4-5-6-7-12-8-10-13(11-9-12)14(15)16-2;1-16-8(13)6-2-4-7(5-3-6)17-18(14,15)9(10,11)12/h8-11H,3-7H2,1-2H3;2-5H,1H3 |
| InChIKey | LMHJRIXLIJREMT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate?
The IUPAC name of methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate (CID 159392495) is methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate.
What is the SMILES notation for methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate?
The canonical SMILES for methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate is CCCCCCc1ccc(C(=O)OC)cc1.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate?
The InChIKey is LMHJRIXLIJREMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2.C9H7F3O5S/c1-3-4-5-6-7-12-8-10-13(11-9-12)14(15)16-2;1-16-8(13)6-2-4-7(5-3-6)17-18(14,15)9(10,11)12/h8-11H,3-7H2,1-2H3;2-5H,1H3.
What are the key properties of methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate?
methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate has a molecular weight of 504.52 g/mol, XLogP of 5.30, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hexylbenzoate;methyl 4-(trifluoromethylsulfonyloxy)benzoate is sourced from PubChem (CID 159392495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).