C44H39BrN10O8 — CID 159392541
8-bromoquinoxaline-5-carbonitrile;[(3S,5S)-1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl] 4-nitrobenzoate;[(3S,5S)-5-methylpiperidin-3-yl] 4-nitrobenzoate (PubChem CID 159392541) has the molecular formula C44H39BrN10O8 and a molecular weight of 915.76 g/mol. Its IUPAC name is 8-bromoquinoxaline-5-carbonitrile;[(3S,5S)-1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl] 4-nitrobenzoate;[(3S,5S)-5-methylpiperidin-3-yl] 4-nitrobenzoate.
| Compound Name | 8-bromoquinoxaline-5-carbonitrile;[(3S,5S)-1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl] 4-nitrobenzoate;[(3S,5S)-5-methylpiperidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 159392541 |
| Molecular Formula | C44H39BrN10O8 |
| Molecular Weight | 915.76 g/mol |
| Exact Mass | 914.21 |
| IUPAC Name | 8-bromoquinoxaline-5-carbonitrile;[(3S,5S)-1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl] 4-nitrobenzoate;[(3S,5S)-5-methylpiperidin-3-yl] 4-nitrobenzoate |
| SMILES | C[C@@H]1CNC[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1.C[C@H]1C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN(c2ccc(C#N)c3nccnc23)C1.N#Cc1ccc(Br)c2nccnc12 |
| InChI | InChI=1S/C22H19N5O4.C13H16N2O4.C9H4BrN3/c1-14-10-18(31-22(28)15-2-5-17(6-3-15)27(29)30)13-26(12-14)19-7-4-16(11-23)20-21(19)25-9-8-24-20;1-9-6-12(8-14-7-9)19-13(16)10-2-4-11(5-3-10)15(17)18;10-7-2-1-6(5-11)8-9(7)13-4-3-12-8/h2-9,14,18H,10,12-13H2,1H3;2-5,9,12,14H,6-8H2,1H3;1-4H/t14-,18-;9-,12-;/m00./s1 |
| InChIKey | LMHNMAMBSBLJGK-SOOLWCJYSA-N |
| XLogP | 7.50 |
| TPSA | 253.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|