C42H35BrO8 — CID 159392608
ethyl 3-(2-bromophenyl)-3-oxopropanoate;2-[3-[2-[3-(hydroxymethyl)-4,5-diphenylfuran-2-yl]phenyl]phenoxy]acetic acid (PubChem CID 159392608) has the molecular formula C42H35BrO8 and a molecular weight of 747.64 g/mol. Its IUPAC name is ethyl 3-(2-bromophenyl)-3-oxopropanoate;2-[3-[2-[3-(hydroxymethyl)-4,5-diphenylfuran-2-yl]phenyl]phenoxy]acetic acid.
| Compound Name | ethyl 3-(2-bromophenyl)-3-oxopropanoate;2-[3-[2-[3-(hydroxymethyl)-4,5-diphenylfuran-2-yl]phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 159392608 |
| Molecular Formula | C42H35BrO8 |
| Molecular Weight | 747.64 g/mol |
| Exact Mass | 746.15 |
| IUPAC Name | ethyl 3-(2-bromophenyl)-3-oxopropanoate;2-[3-[2-[3-(hydroxymethyl)-4,5-diphenylfuran-2-yl]phenyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)CC(=O)c1ccccc1Br.O=C(O)COc1cccc(-c2ccccc2-c2oc(-c3ccccc3)c(-c3ccccc3)c2CO)c1 |
| InChI | InChI=1S/C31H24O5.C11H11BrO3/c32-19-27-29(21-10-3-1-4-11-21)30(22-12-5-2-6-13-22)36-31(27)26-17-8-7-16-25(26)23-14-9-15-24(18-23)35-20-28(33)34;1-2-15-11(14)7-10(13)8-5-3-4-6-9(8)12/h1-18,32H,19-20H2,(H,33,34);3-6H,2,7H2,1H3 |
| InChIKey | LMHRXVQEOVDIIY-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.64 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|