C28H44OS — CID 159392664
(2S)-1-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-3-ethylpentan-2-ol (PubChem CID 159392664) has the molecular formula C28H44OS and a molecular weight of 428.73 g/mol. Its IUPAC name is (2S)-1-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-3-ethylpentan-2-ol.
| Compound Name | (2S)-1-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 159392664 |
| Molecular Formula | C28H44OS |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (2S)-1-[2-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylsulfanyl]-3-ethylpentan-2-ol |
| SMILES | CCC(CC)[C@H](O)CSCCC1=CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H44OS/c1-5-20(6-2)26(29)19-30-18-15-22-11-13-24-23-12-10-21-9-7-8-16-27(21,3)25(23)14-17-28(22,24)4/h10-12,20,24-26,29H,5-9,13-19H2,1-4H3/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | LMHWTENTKQIQOE-AJIIGFCHSA-N |
| XLogP | 7.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|