C28H45N7O18S3 — CID 159392795
2-[2-[2-(2-acetyloxyethylsulfamoylcarbamoyloxy)ethyl-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]ethoxycarbonyl]amino]ethoxycarbonylsulfamoylamino]ethyl acetate (PubChem CID 159392795) has the molecular formula C28H45N7O18S3 and a molecular weight of 863.90 g/mol. Its IUPAC name is 2-[2-[2-(2-acetyloxyethylsulfamoylcarbamoyloxy)ethyl-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]ethoxycarbonyl]amino]ethoxycarbonylsulfamoylamino]ethyl acetate.
| Compound Name | 2-[2-[2-(2-acetyloxyethylsulfamoylcarbamoyloxy)ethyl-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]ethoxycarbonyl]amino]ethoxycarbonylsulfamoylamino]ethyl acetate |
|---|---|
| PubChem CID | 159392795 |
| Molecular Formula | C28H45N7O18S3 |
| Molecular Weight | 863.90 g/mol |
| Exact Mass | 863.20 |
| IUPAC Name | 2-[2-[2-(2-acetyloxyethylsulfamoylcarbamoyloxy)ethyl-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylsulfamoylamino]ethoxycarbonyl]amino]ethoxycarbonylsulfamoylamino]ethyl acetate |
| SMILES | CC(=O)OCCNS(=O)(=O)NC(=O)OCCN(CCOC(=O)NS(=O)(=O)NCCOC(C)=O)C(=O)OCCNS(=O)(=O)NC(=O)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C28H45N7O18S3/c1-20(36)48-14-9-29-54(42,43)32-25(38)50-17-12-35(13-18-51-26(39)33-55(44,45)30-10-15-49-21(2)37)28(41)52-16-11-31-56(46,47)34-27(40)53-19-24-22-7-5-3-4-6-8-23(22)24/h22-24,29-31H,5-19H2,1-2H3,(H,32,38)(H,33,39)(H,34,40)/t22-,23+,24? |
| InChIKey | BWHDDLDQICNFEW-VSGJHWFKSA-N |
| XLogP | -2.33 |
| TPSA | 335.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.90 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|