About 2,5-ditert-butyltetrazole
2,5-ditert-butyltetrazole (PubChem CID 15939362) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2,5-ditert-butyltetrazole.
Molecular Properties
| Compound Name | 2,5-ditert-butyltetrazole |
| PubChem CID | 15939362 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2,5-ditert-butyltetrazole |
| SMILES | CC(C)(C)c1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/C9H18N4/c1-8(2,3)7-10-12-13(11-7)9(4,5)6/h1-6H3 |
| InChIKey | RJTDUTAQLYUYIA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-ditert-butyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyltetrazole?
The IUPAC name of 2,5-ditert-butyltetrazole (CID 15939362) is 2,5-ditert-butyltetrazole.
What is the SMILES notation for 2,5-ditert-butyltetrazole?
The canonical SMILES for 2,5-ditert-butyltetrazole is CC(C)(C)c1nnn(C(C)(C)C)n1.
What is the InChIKey of 2,5-ditert-butyltetrazole?
The InChIKey is RJTDUTAQLYUYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-8(2,3)7-10-12-13(11-7)9(4,5)6/h1-6H3.
What are the key properties of 2,5-ditert-butyltetrazole?
2,5-ditert-butyltetrazole has a molecular weight of 182.27 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyltetrazole is sourced from PubChem (CID 15939362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).