C24H25N2O4P — CID 159394129
tert-butyl 4-[[4-oxo-2-(phosphorosomethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl]methyl]benzoate (PubChem CID 159394129) has the molecular formula C24H25N2O4P and a molecular weight of 436.45 g/mol. Its IUPAC name is tert-butyl 4-[[4-oxo-2-(phosphorosomethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[4-oxo-2-(phosphorosomethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl]methyl]benzoate |
|---|---|
| PubChem CID | 159394129 |
| Molecular Formula | C24H25N2O4P |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | tert-butyl 4-[[4-oxo-2-(phosphorosomethyl)-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CC2CCc3cc4nc(CP=O)[nH]c(=O)c4cc32)cc1 |
| InChI | InChI=1S/C24H25N2O4P/c1-24(2,3)30-23(28)15-6-4-14(5-7-15)10-16-8-9-17-11-20-19(12-18(16)17)22(27)26-21(25-20)13-31-29/h4-7,11-12,16H,8-10,13H2,1-3H3,(H,25,26,27) |
| InChIKey | YXUZOEZJHRNPEN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|