C23H29F3O4S2 — CID 159394691
dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-hydroxypropane-1-sulfonate (PubChem CID 159394691) has the molecular formula C23H29F3O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-hydroxypropane-1-sulfonate.
| Compound Name | dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 159394691 |
| Molecular Formula | C23H29F3O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | dibenzyl(cyclohexyl)sulfanium;1,1,2-trifluoro-3-hydroxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)CO.c1ccc(C[S+](Cc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25S.C3H5F3O4S/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;4-2(1-7)3(5,6)11(8,9)10/h1-2,4-7,10-13,20H,3,8-9,14-17H2;2,7H,1H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LMOHGYZHMPJCDN-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|