About azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one
azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one (PubChem CID 159395368) has the molecular formula C11H25N3O2S
and a molecular weight of 263.41 g/mol. Its IUPAC name is azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one.
Molecular Properties
| Compound Name | azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one |
| PubChem CID | 159395368 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one |
| SMILES | CC(C)(S)CC(=O)N1CCN(CCO)CC1.N |
| InChI | InChI=1S/C11H22N2O2S.H3N/c1-11(2,16)9-10(15)13-5-3-12(4-6-13)7-8-14;/h14,16H,3-9H2,1-2H3;1H3 |
| InChIKey | LMQJTYLRVMHILG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 78.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one?
The IUPAC name of azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one (CID 159395368) is azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one.
What is the SMILES notation for azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one?
The canonical SMILES for azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one is CC(C)(S)CC(=O)N1CCN(CCO)CC1.N.
What is the InChIKey of azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one?
The InChIKey is LMQJTYLRVMHILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2S.H3N/c1-11(2,16)9-10(15)13-5-3-12(4-6-13)7-8-14;/h14,16H,3-9H2,1-2H3;1H3.
What are the key properties of azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one?
azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one has a molecular weight of 263.41 g/mol, XLogP of 0.38, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-methyl-3-sulfanylbutan-1-one is sourced from PubChem (CID 159395368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).