C32H38N6O10 — CID 159396575
tert-butyl 7-[3-(4-cyano-2-nitrophenoxy)-2-hydroxypropyl]-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate;3-nitro-4-(oxiran-2-ylmethoxy)benzonitrile (PubChem CID 159396575) has the molecular formula C32H38N6O10 and a molecular weight of 666.69 g/mol. Its IUPAC name is tert-butyl 7-[3-(4-cyano-2-nitrophenoxy)-2-hydroxypropyl]-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate;3-nitro-4-(oxiran-2-ylmethoxy)benzonitrile.
| Compound Name | tert-butyl 7-[3-(4-cyano-2-nitrophenoxy)-2-hydroxypropyl]-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate;3-nitro-4-(oxiran-2-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 159396575 |
| Molecular Formula | C32H38N6O10 |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | tert-butyl 7-[3-(4-cyano-2-nitrophenoxy)-2-hydroxypropyl]-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate;3-nitro-4-(oxiran-2-ylmethoxy)benzonitrile |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(CN(CC(O)COc3ccc(C#N)cc3[N+](=O)[O-])C2)C1.N#Cc1ccc(OCC2CO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H30N4O6.C10H8N2O4/c1-22(2,3)32-21(28)25-11-16-6-17(12-25)10-24(9-16)13-18(27)14-31-20-5-4-15(8-23)7-19(20)26(29)30;11-4-7-1-2-10(9(3-7)12(13)14)16-6-8-5-15-8/h4-5,7,16-18,27H,6,9-14H2,1-3H3;1-3,8H,5-6H2 |
| InChIKey | LMUKSIODMPEWIO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 217.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|