About cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one
cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one (PubChem CID 15939672) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one |
| PubChem CID | 15939672 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one |
| SMILES | O=C1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O3/c7-4-2-1-3-5(8)6(4)9/h4,6-7,9H,1-3H2/t4-,6+/m1/s1 |
| InChIKey | VLKBFBQNKKKELE-XINAWCOVSA-N |
| XLogP | -0.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one?
The IUPAC name of cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one (CID 15939672) is cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one.
What is the SMILES notation for cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one?
The canonical SMILES for cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one is O=C1CCC[C@@H](O)[C@@H]1O.
What is the InChIKey of cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one?
The InChIKey is VLKBFBQNKKKELE-XINAWCOVSA-N. The full InChI is InChI=1S/C6H10O3/c7-4-2-1-3-5(8)6(4)9/h4,6-7,9H,1-3H2/t4-,6+/m1/s1.
What are the key properties of cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one?
cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one has a molecular weight of 130.14 g/mol, XLogP of -0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3R)-2,3-dihydroxycyclohexan-1-one is sourced from PubChem (CID 15939672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).