C18H19F3N2O2S2 — CID 159397663
1-[5-cyclopropyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8,8,8-trifluorooctane-1,7-dione (PubChem CID 159397663) has the molecular formula C18H19F3N2O2S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-[5-cyclopropyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8,8,8-trifluorooctane-1,7-dione.
| Compound Name | 1-[5-cyclopropyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8,8,8-trifluorooctane-1,7-dione |
|---|---|
| PubChem CID | 159397663 |
| Molecular Formula | C18H19F3N2O2S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-[5-cyclopropyl-2-(5-methyl-1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8,8,8-trifluorooctane-1,7-dione |
| SMILES | Cc1cnc(-c2nc(C(=O)CCCCCC(=O)C(F)(F)F)c(C3CC3)s2)s1 |
| InChI | InChI=1S/C18H19F3N2O2S2/c1-10-9-22-16(26-10)17-23-14(15(27-17)11-7-8-11)12(24)5-3-2-4-6-13(25)18(19,20)21/h9,11H,2-8H2,1H3 |
| InChIKey | LMYBWHBWZMEWTK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|