C16H28N2 — CID 15939849
(1S,2R,9S,10R)-2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 15939849) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (1S,2R,9S,10R)-2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (1S,2R,9S,10R)-2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 15939849 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (1S,2R,9S,10R)-2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | C[C@]12CCCCN1C[C@@H]1C[C@H]2CN2CCCC[C@H]12 |
| InChI | InChI=1S/C16H28N2/c1-16-7-3-5-9-18(16)11-13-10-14(16)12-17-8-4-2-6-15(13)17/h13-15H,2-12H2,1H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | CMKZBDRPQFPVHH-CAOSSQGBSA-N |
| XLogP | 2.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |