C16H26N2O — CID 15939872
(1S,2S,9R,10R)-10-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one (PubChem CID 15939872) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is (1S,2S,9R,10R)-10-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one.
| Compound Name | (1S,2S,9R,10R)-10-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one |
|---|---|
| PubChem CID | 15939872 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (1S,2S,9R,10R)-10-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-8-one |
| SMILES | C[C@]12CCCCN1C[C@@H]1C[C@H]2C(=O)N2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H26N2O/c1-16-7-3-5-8-17(16)11-12-10-13(16)15(19)18-9-4-2-6-14(12)18/h12-14H,2-11H2,1H3/t12-,13-,14-,16+/m0/s1 |
| InChIKey | LICMSVPJBDAULC-RZLSGREXSA-N |
| XLogP | 2.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |