C16H24N2O3 — CID 15939880
methyl (1R,2R,9R,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate (PubChem CID 15939880) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (1R,2R,9R,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate.
| Compound Name | methyl (1R,2R,9R,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate |
|---|---|
| PubChem CID | 15939880 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl (1R,2R,9R,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate |
| SMILES | C=CC[C@H]1[C@@H]2C[C@H](CN1C(=O)OC)[C@H]1CCCC(=O)N1C2 |
| InChI | InChI=1S/C16H24N2O3/c1-3-5-13-11-8-12(10-18(13)16(20)21-2)14-6-4-7-15(19)17(14)9-11/h3,11-14H,1,4-10H2,2H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | SNVJEHVKQNQUBG-YIYPIFLZSA-N |
| XLogP | 2.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|