C17H26N2O3 — CID 15939881
ethyl (1S,2R,9S,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate (PubChem CID 15939881) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is ethyl (1S,2R,9S,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate.
| Compound Name | ethyl (1S,2R,9S,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate |
|---|---|
| PubChem CID | 15939881 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | ethyl (1S,2R,9S,10S)-6-oxo-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carboxylate |
| SMILES | C=CC[C@H]1[C@H]2C[C@@H](CN1C(=O)OCC)[C@H]1CCCC(=O)N1C2 |
| InChI | InChI=1S/C17H26N2O3/c1-3-6-14-12-9-13(11-19(14)17(21)22-4-2)15-7-5-8-16(20)18(15)10-12/h3,12-15H,1,4-11H2,2H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | XPLHFSXEZDJFCO-ZQDZILKHSA-N |
| XLogP | 2.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|