C20H27N3O5 — CID 15939898
[(1S,2S,4S,9S,10R,12R,13S)-12,13-dihydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate (PubChem CID 15939898) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(1S,2S,4S,9S,10R,12R,13S)-12,13-dihydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(1S,2S,4S,9S,10R,12R,13S)-12,13-dihydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 15939898 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [(1S,2S,4S,9S,10R,12R,13S)-12,13-dihydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(O[C@H]1CCN2C[C@@H]3C[C@@H](CN4C(=O)[C@@H](O)[C@H](O)C[C@H]34)[C@@H]2C1)c1ccc[nH]1 |
| InChI | InChI=1S/C20H27N3O5/c24-17-8-16-11-6-12(10-23(16)19(26)18(17)25)15-7-13(3-5-22(15)9-11)28-20(27)14-2-1-4-21-14/h1-2,4,11-13,15-18,21,24-25H,3,5-10H2/t11-,12-,13-,15-,16+,17+,18-/m0/s1 |
| InChIKey | JCBFTVVDJBFDDD-IVTQDWLDSA-N |
| XLogP | -0.02 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |