C17H16F4O — CID 15939942
6-(4-butyl-2,3,5,6-tetrafluorophenyl)-2-methylhexa-3,5-diyn-2-ol (PubChem CID 15939942) has the molecular formula C17H16F4O and a molecular weight of 312.31 g/mol. Its IUPAC name is 6-(4-butyl-2,3,5,6-tetrafluorophenyl)-2-methylhexa-3,5-diyn-2-ol.
| Compound Name | 6-(4-butyl-2,3,5,6-tetrafluorophenyl)-2-methylhexa-3,5-diyn-2-ol |
|---|---|
| PubChem CID | 15939942 |
| Molecular Formula | C17H16F4O |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6-(4-butyl-2,3,5,6-tetrafluorophenyl)-2-methylhexa-3,5-diyn-2-ol |
| SMILES | CCCCc1c(F)c(F)c(C#CC#CC(C)(C)O)c(F)c1F |
| InChI | InChI=1S/C17H16F4O/c1-4-5-8-11-13(18)15(20)12(16(21)14(11)19)9-6-7-10-17(2,3)22/h22H,4-5,8H2,1-3H3 |
| InChIKey | UOMPAPWAQCXJFD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|