C12H16O7 — CID 15939962
methyl (3R,4R,5R)-4,5-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)oxycyclohexene-1-carboxylate (PubChem CID 15939962) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is methyl (3R,4R,5R)-4,5-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)oxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5R)-4,5-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)oxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 15939962 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | methyl (3R,4R,5R)-4,5-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)oxycyclohexene-1-carboxylate |
| SMILES | C=C(O[C@@H]1C=C(C(=O)OC)C[C@@H](O)[C@H]1O)C(=O)OC |
| InChI | InChI=1S/C12H16O7/c1-6(11(15)17-2)19-9-5-7(12(16)18-3)4-8(13)10(9)14/h5,8-10,13-14H,1,4H2,2-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | LXXNOOUDPRVEFK-OPRDCNLKSA-N |
| XLogP | -0.72 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|