C14H22O — CID 15939975
2,2,9,9-tetramethyldeca-5,7-diyn-4-ol (PubChem CID 15939975) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,2,9,9-tetramethyldeca-5,7-diyn-4-ol.
| Compound Name | 2,2,9,9-tetramethyldeca-5,7-diyn-4-ol |
|---|---|
| PubChem CID | 15939975 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2,2,9,9-tetramethyldeca-5,7-diyn-4-ol |
| SMILES | CC(C)(C)C#CC#CC(O)CC(C)(C)C |
| InChI | InChI=1S/C14H22O/c1-13(2,3)10-8-7-9-12(15)11-14(4,5)6/h12,15H,11H2,1-6H3 |
| InChIKey | LLXZMTUJPSLDES-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|