C11H18O2S — CID 15940005
1,4,5,6,7-pentamethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide (PubChem CID 15940005) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 1,4,5,6,7-pentamethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide.
| Compound Name | 1,4,5,6,7-pentamethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide |
|---|---|
| PubChem CID | 15940005 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1,4,5,6,7-pentamethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide |
| SMILES | CC1=C(C)C2(C)C(C)C1(C)CS2(=O)=O |
| InChI | InChI=1S/C11H18O2S/c1-7-8(2)11(5)9(3)10(7,4)6-14(11,12)13/h9H,6H2,1-5H3 |
| InChIKey | UJADYDZZTKKPQM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|