About CID 15940426
CID 15940426 (PubChem CID 15940426) has the molecular formula C64H85Cl2N2PRu
and a molecular weight of 1085.35 g/mol.
Molecular Properties
| Compound Name | CID 15940426 |
| PubChem CID | 15940426 |
| Molecular Formula | C64H85Cl2N2PRu |
| Molecular Weight | 1085.35 g/mol |
| Exact Mass | 1084.49 |
| IUPAC Name | — |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)c1ccc(C(C)C)c(N2[C]N(c3cc(C(C)C)ccc3C(C)C)[C@H](c3ccccc3)[C@H]2c2ccccc2)c1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C39H46N2.C18H33P.C7H6.2ClH.Ru/c1-26(2)32-19-21-34(28(5)6)36(23-32)40-25-41(37-24-33(27(3)4)20-22-35(37)29(7)8)39(31-17-13-10-14-18-31)38(40)30-15-11-9-12-16-30;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h9-24,26-29,38-39H,1-8H3;16-18H,1-15H2;1-6H;2*1H;/q;;;;;+2/p-2/t38-,39-;;;;;/m1...../s1 |
| InChIKey | KQWGGACVMDQHPK-AXOGFSHHSA-L |
| XLogP | 20.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1085.35 |
| LogP ≤ 5 | 20.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 15940426 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15940426?
The IUPAC name of CID 15940426 (CID 15940426) is not available.
What is the SMILES notation for CID 15940426?
The canonical SMILES for CID 15940426 is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)c1ccc(C(C)C)c(N2[C]N(c3cc(C(C)C)ccc3C(C)C)[C@H](c3ccccc3)[C@H]2c2ccccc2)c1.Cl[Ru](Cl)=Cc1ccccc1.
What is the InChIKey of CID 15940426?
The InChIKey is KQWGGACVMDQHPK-AXOGFSHHSA-L. The full InChI is InChI=1S/C39H46N2.C18H33P.C7H6.2ClH.Ru/c1-26(2)32-19-21-34(28(5)6)36(23-32)40-25-41(37-24-33(27(3)4)20-22-35(37)29(7)8)39(31-17-13-10-14-18-31)38(40)30-15-11-9-12-16-30;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h9-24,26-29,38-39H,1-8H3;16-18H,1-15H2;1-6H;2*1H;/q;;;;;+2/p-2/t38-,39-;;;;;/m1...../s1.
What are the key properties of CID 15940426?
CID 15940426 has a molecular weight of 1085.35 g/mol, XLogP of 20.21, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15940426 is sourced from PubChem (CID 15940426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).