C27H49N2Ru — CID 159404801
2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;2-(2,4-dimethylpentan-2-yl)-4,4,5,5-tetramethyl-3H-pyrrole;ruthenium(1+) (PubChem CID 159404801) has the molecular formula C27H49N2Ru and a molecular weight of 502.77 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;2-(2,4-dimethylpentan-2-yl)-4,4,5,5-tetramethyl-3H-pyrrole;ruthenium(1+).
| Compound Name | 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;2-(2,4-dimethylpentan-2-yl)-4,4,5,5-tetramethyl-3H-pyrrole;ruthenium(1+) |
|---|---|
| PubChem CID | 159404801 |
| Molecular Formula | C27H49N2Ru |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;2-(2,4-dimethylpentan-2-yl)-4,4,5,5-tetramethyl-3H-pyrrole;ruthenium(1+) |
| SMILES | CC(C)CC(C)(C)C1=NC(C)(C)C(C)(C)C1.CC1=[C-]CC(C(C)(C)CC(C)C)=N1.[Ru+] |
| InChI | InChI=1S/C15H29N.C12H20N.Ru/c1-11(2)9-13(3,4)12-10-14(5,6)15(7,8)16-12;1-9(2)8-12(4,5)11-7-6-10(3)13-11;/h11H,9-10H2,1-8H3;9H,7-8H2,1-5H3;/q;-1;+1 |
| InChIKey | UTMOENUVJQUPBH-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|