About [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane
[(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane (PubChem CID 159404818) has the molecular formula C22H42N2O2
and a molecular weight of 366.59 g/mol. Its IUPAC name is [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane.
Molecular Properties
| Compound Name | [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane |
| PubChem CID | 159404818 |
| Molecular Formula | C22H42N2O2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.[CH2+]CC[N-][C@@H](C=O)CC(N)=O.[CH2+]C[CH2-] |
| InChI | InChI=1S/C7H12N2O2.C3H6.6C2H4/c1-2-3-9-6(5-10)4-7(8)11;1-3-2;6*1-2/h5-6H,1-4H2,(H2,8,11);1-3H2;6*1-2H2/t6-;;;;;;;/m1......./s1 |
| InChIKey | LNUWGDOLISMFFA-QCWBIAMCSA-N |
| XLogP | 5.89 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane?
The IUPAC name of [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane (CID 159404818) is [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane.
What is the SMILES notation for [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane?
The canonical SMILES for [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane is C=C.C=C.C=C.C=C.C=C.C=C.[CH2+]CC[N-][C@@H](C=O)CC(N)=O.[CH2+]C[CH2-].
What is the InChIKey of [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane?
The InChIKey is LNUWGDOLISMFFA-QCWBIAMCSA-N. The full InChI is InChI=1S/C7H12N2O2.C3H6.6C2H4/c1-2-3-9-6(5-10)4-7(8)11;1-3-2;6*1-2/h5-6H,1-4H2,(H2,8,11);1-3H2;6*1-2H2/t6-;;;;;;;/m1......./s1.
What are the key properties of [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane?
[(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane has a molecular weight of 366.59 g/mol, XLogP of 5.89, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-amino-1,4-dioxobutan-2-yl]-propylazanide;ethene;propane is sourced from PubChem (CID 159404818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).