About 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one
1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one (PubChem CID 159405315) has the molecular formula C17H30O
and a molecular weight of 250.43 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one |
| PubChem CID | 159405315 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one |
| SMILES | CC(C)=CC1CCC(C=C(C)C)C1.CCC(C)=O |
| InChI | InChI=1S/C13H22.C4H8O/c1-10(2)7-12-5-6-13(9-12)8-11(3)4;1-3-4(2)5/h7-8,12-13H,5-6,9H2,1-4H3;3H2,1-2H3 |
| InChIKey | LNWNGKLEWJKBSC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one?
The IUPAC name of 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one (CID 159405315) is 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one.
What is the SMILES notation for 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one?
The canonical SMILES for 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one is CC(C)=CC1CCC(C=C(C)C)C1.CCC(C)=O.
What is the InChIKey of 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one?
The InChIKey is LNWNGKLEWJKBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22.C4H8O/c1-10(2)7-12-5-6-13(9-12)8-11(3)4;1-3-4(2)5/h7-8,12-13H,5-6,9H2,1-4H3;3H2,1-2H3.
What are the key properties of 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one?
1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one has a molecular weight of 250.43 g/mol, XLogP of 5.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-methylprop-1-enyl)cyclopentane;butan-2-one is sourced from PubChem (CID 159405315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).