About ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one
ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one (PubChem CID 159406696) has the molecular formula C12H27NOS
and a molecular weight of 233.42 g/mol. Its IUPAC name is ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one |
| PubChem CID | 159406696 |
| Molecular Formula | C12H27NOS |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one |
| SMILES | CC.CC(C)C.CC(C)N1CCSC1=O |
| InChI | InChI=1S/C6H11NOS.C4H10.C2H6/c1-5(2)7-3-4-9-6(7)8;1-4(2)3;1-2/h5H,3-4H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | LOAYLLLSPONVRF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one?
The IUPAC name of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one (CID 159406696) is ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one.
What is the SMILES notation for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one?
The canonical SMILES for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one is CC.CC(C)C.CC(C)N1CCSC1=O.
What is the InChIKey of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one?
The InChIKey is LOAYLLLSPONVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS.C4H10.C2H6/c1-5(2)7-3-4-9-6(7)8;1-4(2)3;1-2/h5H,3-4H2,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one?
ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one has a molecular weight of 233.42 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazolidin-2-one is sourced from PubChem (CID 159406696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).