C11H21N3O3 — CID 15940706
2-hydroxyethyl(trimethyl)azanium;4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate (PubChem CID 15940706) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate |
|---|---|
| PubChem CID | 15940706 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate |
| SMILES | C[N+](C)(C)CCO.[O-]c1noc2c1CCNC2 |
| InChI | InChI=1S/C6H8N2O2.C5H14NO/c9-6-4-1-2-7-3-5(4)10-8-6;1-6(2,3)4-5-7/h7H,1-3H2,(H,8,9);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | JQXPAURXSWSTHX-UHFFFAOYSA-M |
| XLogP | -0.92 |
| TPSA | 81.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|