C20H32N5+ — CID 159407092
2-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-2H-imidazol-1-yl]-1-methyl-6-[(2R)-2-methyl-3-(1,1,1,2-tetradeuteriopropan-2-yl)-2H-imidazol-1-yl]pyridin-1-ium (PubChem CID 159407092) has the molecular formula C20H32N5+ and a molecular weight of 353.58 g/mol. Its IUPAC name is 2-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-2H-imidazol-1-yl]-1-methyl-6-[(2R)-2-methyl-3-(1,1,1,2-tetradeuteriopropan-2-yl)-2H-imidazol-1-yl]pyridin-1-ium.
| Compound Name | 2-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-2H-imidazol-1-yl]-1-methyl-6-[(2R)-2-methyl-3-(1,1,1,2-tetradeuteriopropan-2-yl)-2H-imidazol-1-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 159407092 |
| Molecular Formula | C20H32N5+ |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | 2-[(2S)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-methyl-2H-imidazol-1-yl]-1-methyl-6-[(2R)-2-methyl-3-(1,1,1,2-tetradeuteriopropan-2-yl)-2H-imidazol-1-yl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(C)N1C=CN(c2cccc(N3C=CN(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[C@@H]3C)[n+]2C)[C@@H]1C |
| InChI | InChI=1S/C20H32N5/c1-15(2)22-11-13-24(17(22)5)19-9-8-10-20(21(19)7)25-14-12-23(16(3)4)18(25)6/h8-18H,1-7H3/q+1/t17-,18+/i1D3,2D3,3D3,15D,16D/t16?,17-,18+/m0/s1 |
| InChIKey | VGNLAPOAFRCETN-LYGYTBSDSA-N |
| XLogP | 3.21 |
| TPSA | 16.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|