About benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane
benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane (PubChem CID 159409426) has the molecular formula C25H44N4
and a molecular weight of 400.66 g/mol. Its IUPAC name is benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane.
Molecular Properties
| Compound Name | benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane |
| PubChem CID | 159409426 |
| Molecular Formula | C25H44N4 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane |
| SMILES | CC.CC.CC.CC.CCc1nc(-c2ccncn2)c(CC)[nH]1.c1ccccc1 |
| InChI | InChI=1S/C11H14N4.C6H6.4C2H6/c1-3-8-11(15-10(4-2)14-8)9-5-6-12-7-13-9;1-2-4-6-5-3-1;4*1-2/h5-7H,3-4H2,1-2H3,(H,14,15);1-6H;4*1-2H3 |
| InChIKey | LOJPSNDZNGMYQW-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane?
The IUPAC name of benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane (CID 159409426) is benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane.
What is the SMILES notation for benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane?
The canonical SMILES for benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane is CC.CC.CC.CC.CCc1nc(-c2ccncn2)c(CC)[nH]1.c1ccccc1.
What is the InChIKey of benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane?
The InChIKey is LOJPSNDZNGMYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4.C6H6.4C2H6/c1-3-8-11(15-10(4-2)14-8)9-5-6-12-7-13-9;1-2-4-6-5-3-1;4*1-2/h5-7H,3-4H2,1-2H3,(H,14,15);1-6H;4*1-2H3.
What are the key properties of benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane?
benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane has a molecular weight of 400.66 g/mol, XLogP of 7.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-(2,5-diethyl-1H-imidazol-4-yl)pyrimidine;ethane is sourced from PubChem (CID 159409426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).